CAS 548-66-3 appears in our catalog under these names: Drofenine Hydrochloride, >95% (HPLC), Drofenine Hydrochloride, Drofenine hydrochloride/ 99.53% (existing batch purity), Drofenine hydrochloride (Hexahydroadiphenine hydrochloride), Drofenine HCl 98%. Offered by: TRC, Mikromol, LoGiCal, TargetMol, GLPBio. Available pack sizes: 100mg, 1g, 500mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 0,1g.
2-(diethylamino)ethyl 2-cyclohexyl-2-phenylacetate;hydrochloride (CAS 548-66-3) is a chemical compound with the molecular formula C20H32ClNO2 and a molecular weight of 353.9 g/mol. IUPAC name: 2-(diethylamino)ethyl 2-cyclohexyl-2-phenylacetate;hydrochloride. InChIKey: WIELVDXKOYPANK-UHFFFAOYSA-N.
| Molecular formula | C20H32ClNO2 |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 2-cyclohexyl-2-phenylacetate;hydrochloride |
| InChIKey | WIELVDXKOYPANK-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(C1CCCCC1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)