CAS 548-80-1 appears in our catalog under these names: Chromotrope 2B, 98%, Chromotrope 2B, Chromotrope 2B/ 95.45% (existing batch purity), Chromotrope 2B , Chromotrope 2B. Offered by: AmBeed, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 5mg, 10mg, 25mg, 50mg.
Disodium;4,5-dihydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate (CAS 548-80-1) is a chemical compound with the molecular formula C16H9N3Na2O10S2 and a molecular weight of 513.4 g/mol. IUPAC name: disodium;4,5-dihydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate. InChIKey: AXUUHWJXDWBCSG-UHFFFAOYSA-L.
| Molecular formula | C16H9N3Na2O10S2 |
|---|---|
| Molecular weight | 513.4 g/mol |
| IUPAC name | disodium;4,5-dihydroxy-3-[(4-nitrophenyl)diazenyl]naphthalene-2,7-disulfonate |
| InChIKey | AXUUHWJXDWBCSG-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC=C1N=NC2=C(C3=C(C=C(C=C3C=C2S(=O)(=O)[O-])S(=O)(=O)[O-])O)O)[N+](=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)