CAS 54824-37-2 appears in our catalog under these names: Disperse yellow 49, 95%, Disperse Yellow 49, Disperse Yellow 49 (Technical Grade), Disperse yellow 49, technical grade dye content. Offered by: Combi-blocks, Chemat Brand, TRC, Biosynth. Available pack sizes: 250mg, 1g, on request, 10mg, 2,5mg, 25mg, 5mg, 2mg.
2-[4-(dicyanomethyl)-N-ethyl-3-methylanilino]ethyl N-phenylcarbamate (CAS 54824-37-2) is a chemical compound with the molecular formula C21H22N4O2 and a molecular weight of 362.4 g/mol. IUPAC name: 2-[4-(dicyanomethyl)-N-ethyl-3-methylanilino]ethyl N-phenylcarbamate. InChIKey: YSOHRODHDJYIPG-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[4-(dicyanomethyl)-N-ethyl-3-methylanilino]ethyl N-phenylcarbamate |
| InChIKey | YSOHRODHDJYIPG-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)NC1=CC=CC=C1)C2=CC(=C(C=C2)C(C#N)C#N)C |
Computed by PubChem (NCBI)