CAS 548488-35-3 is the registry number for (R)-1-Isopropyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-propan-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (CAS 548488-35-3) is a chemical compound with the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. IUPAC name: (1R)-1-propan-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole. InChIKey: ANFOWSMYMVVVLD-CYBMUJFWSA-N.
| Molecular formula | C14H18N2 |
|---|---|
| Molecular weight | 214.31 g/mol |
| IUPAC name | (1R)-1-propan-2-yl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| InChIKey | ANFOWSMYMVVVLD-CYBMUJFWSA-N |
| SMILES | CC(C)[C@@H]1C2=C(CCN1)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)