CAS 54864-78-7 is the registry number for 3-(Heptafluoro-n-propyl)-5-phenylpyrazole, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 25g.
5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole (CAS 54864-78-7) is a chemical compound with the molecular formula C12H7F7N2 and a molecular weight of 312.19 g/mol. IUPAC name: 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole. InChIKey: JZKFJUIBEKMWRF-UHFFFAOYSA-N.
| Molecular formula | C12H7F7N2 |
|---|---|
| Molecular weight | 312.19 g/mol |
| IUPAC name | 5-(1,1,2,2,3,3,3-heptafluoropropyl)-3-phenyl-1H-pyrazole |
| InChIKey | JZKFJUIBEKMWRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=C2)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)