CAS 54865-40-6 appears in our catalog under these names: Calcium phenylpyruvate, 95%, Calcium, bis[α-(oxo-κO)benzenepropanoato-κO]-, (T-4)-, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, on request.
Calcium bis(2-oxo-3-phenylpropanoate) (CAS 54865-40-6) is a chemical compound with the molecular formula C18H14CaO6 and a molecular weight of 366.4 g/mol. IUPAC name: calcium bis(2-oxo-3-phenylpropanoate). InChIKey: BKMMOJVSLBZNTK-UHFFFAOYSA-L.
| Molecular formula | C18H14CaO6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | calcium bis(2-oxo-3-phenylpropanoate) |
| InChIKey | BKMMOJVSLBZNTK-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)CC(=O)C(=O)[O-].C1=CC=C(C=C1)CC(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)