CAS 54878-01-2 is the registry number for Methyl(1R,3S)-2,2-dimethyl-3-(2-oxopropyl)-cyclopropaneacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(1R,3S)-2,2-dimethyl-3-(2-oxopropyl)cyclopropyl]acetate (CAS 54878-01-2) is a chemical compound with the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. IUPAC name: methyl 2-[(1R,3S)-2,2-dimethyl-3-(2-oxopropyl)cyclopropyl]acetate. InChIKey: MGHKLYIYPFGGDY-DTWKUNHWSA-N.
| Molecular formula | C11H18O3 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | methyl 2-[(1R,3S)-2,2-dimethyl-3-(2-oxopropyl)cyclopropyl]acetate |
| InChIKey | MGHKLYIYPFGGDY-DTWKUNHWSA-N |
| SMILES | CC(=O)C[C@H]1[C@H](C1(C)C)CC(=O)OC |
Computed by PubChem (NCBI)