Products 54911-89-6
CAS 54911-89-6 appears in our catalog under these names: Rac-methyl (1r,5r)-5-hydroxycyclohex-3-ene-1-carboxylate, 95%, Cis-methyl 5-hydroxycyclohex-3-ene-1-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g, 50mg.
Methyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate (CAS 54911-89-6) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: methyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate. InChIKey: UQSMDPAVFOFIGB-RQJHMYQMSA-N.
| Molecular formula | C8H12O3 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | methyl (1R,5R)-5-hydroxycyclohex-3-ene-1-carboxylate |
| InChIKey | UQSMDPAVFOFIGB-RQJHMYQMSA-N |
| SMILES | COC(=O)[C@@H]1CC=C[C@@H](C1)O |
Computed by PubChem (NCBI)