Products 54931-98-5
CAS 54931-98-5 is the registry number for 10-Thiofolic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylsulfanyl]benzoyl]amino]pentanedioic acid (CAS 54931-98-5) is a chemical compound with the molecular formula C19H18N6O6S and a molecular weight of 458.4 g/mol. IUPAC name: (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylsulfanyl]benzoyl]amino]pentanedioic acid. InChIKey: VUCAAEQMBTVEOL-LBPRGKRZSA-N.
| Molecular formula | C19H18N6O6S |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylsulfanyl]benzoyl]amino]pentanedioic acid |
| InChIKey | VUCAAEQMBTVEOL-LBPRGKRZSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[C@@H](CCC(=O)O)C(=O)O)SCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)