CAS 54940-95-3 is the registry number for Nitrocaphane. Offered by: Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, Get quote.
2-amino-3-[2-[bis(2-chloroethyl)aminomethyl]-5-nitrophenyl]propanoic acid (CAS 54940-95-3) is a chemical compound with the molecular formula C14H19Cl2N3O4 and a molecular weight of 364.2 g/mol. IUPAC name: 2-amino-3-[2-[bis(2-chloroethyl)aminomethyl]-5-nitrophenyl]propanoic acid. InChIKey: VEBTZMUIBMIPCD-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O4 |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | 2-amino-3-[2-[bis(2-chloroethyl)aminomethyl]-5-nitrophenyl]propanoic acid |
| InChIKey | VEBTZMUIBMIPCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CC(C(=O)O)N)CN(CCCl)CCCl |
Computed by PubChem (NCBI)