CAS 549521-94-0 appears in our catalog under these names: Zinc(II) L-cysteinate hydrochloride, 98%, Zinc Cysteinate Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 1g.
Zinc;(2R)-2-amino-3-sulfidopropanoate;hydrochloride (CAS 549521-94-0) is a chemical compound with the molecular formula C3H6ClNO2SZn and a molecular weight of 221.0 g/mol. IUPAC name: zinc;(2R)-2-amino-3-sulfidopropanoate;hydrochloride. InChIKey: ZACWWEXAGRDPTH-JIZZDEOASA-L.
| Molecular formula | C3H6ClNO2SZn |
|---|---|
| Molecular weight | 221.0 g/mol |
| IUPAC name | zinc;(2R)-2-amino-3-sulfidopropanoate;hydrochloride |
| InChIKey | ZACWWEXAGRDPTH-JIZZDEOASA-L |
| SMILES | C([C@@H](C(=O)[O-])N)[S-].Cl.[Zn+2] |
Computed by PubChem (NCBI)