Products 549526-27-4

CAS 549526-27-4 is the registry number for 2-Chloro-6-(3-chloro-4-fluoro-phenyl)-isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylic acid (CAS 549526-27-4) is a chemical compound with the molecular formula C12H6Cl2FNO2 and a molecular weight of 286.08 g/mol. IUPAC name: 2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylic acid. InChIKey: KKGBGELRTSNCJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Cl2FNO2
Molecular weight286.08 g/mol
IUPAC name2-chloro-6-(3-chloro-4-fluorophenyl)pyridine-4-carboxylic acid
InChIKeyKKGBGELRTSNCJJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=NC(=CC(=C2)C(=O)O)Cl)Cl)F

Computed by PubChem (NCBI)