CAS 54970-72-8 appears in our catalog under these names: 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt, 98%, DHBS/ 99.59% (existing batch purity), DHBS (DCHBS), 3,5-Dichloro-2-hydroxybenzenesulfonic acid sodium salt, 98% , 3,5-Dichloro-2-hydroxybenzenesulfonate sodium salt. Offered by: Combi-blocks, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 25g, 100g, 5g, 1g, 10mM (in 1ml water), 10g, 50g, 250g.
Sodium 3,5-dichloro-2-hydroxybenzenesulfonate (CAS 54970-72-8) is a chemical compound with the molecular formula C6H3Cl2NaO4S and a molecular weight of 265.05 g/mol. IUPAC name: sodium 3,5-dichloro-2-hydroxybenzenesulfonate. InChIKey: NMWCVZCSJHJYFW-UHFFFAOYSA-M.
| Molecular formula | C6H3Cl2NaO4S |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | sodium 3,5-dichloro-2-hydroxybenzenesulfonate |
| InChIKey | NMWCVZCSJHJYFW-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1S(=O)(=O)[O-])O)Cl)Cl.[Na+] |
Computed by PubChem (NCBI)