Products 549888-51-9

CAS 549888-51-9 is the registry number for 1-(2-Hydroxyethyl)-1H-imidazole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

1-(2-hydroxyethyl)imidazole-4-carboxylic acid (CAS 549888-51-9) is a chemical compound with the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. IUPAC name: 1-(2-hydroxyethyl)imidazole-4-carboxylic acid. InChIKey: GOQISJZSHJHRGL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O3
Molecular weight156.14 g/mol
IUPAC name1-(2-hydroxyethyl)imidazole-4-carboxylic acid
InChIKeyGOQISJZSHJHRGL-UHFFFAOYSA-N
SMILESC1=C(N=CN1CCO)C(=O)O

Computed by PubChem (NCBI)