CAS 55-63-0 appears in our catalog under these names: Trinitroglycerin (TNG), Glyceryl Trinitrate Solution, Trinitroglycerin, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Hubei YoungXin, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1x1ml.
Nitroglycerin is a nitroglycerol that is glycerol in which the hydrogen atoms of all three hydroxy groups are replaced by nitro groups. It acts as a prodrug, releasing nitric oxide to open blood vessels and so alleviate heart pain. It has a role as a vasodilator agent, a xenobiotic, a prodrug, a nitric oxide donor, a muscle relaxant, an explosive and a tocolytic agent.
Source: ChEBI
| Molecular formula | C3H5N3O9 |
|---|---|
| Molecular weight | 227.09 g/mol |
| IUPAC name | 1,3-dinitrooxypropan-2-yl nitrate |
| InChIKey | SNIOPGDIGTZGOP-UHFFFAOYSA-N |
| SMILES | C(C(CO[N+](=O)[O-])O[N+](=O)[O-])O[N+](=O)[O-] |
Computed by PubChem (NCBI)