CAS 550-43-6 appears in our catalog under these names: Mixture of (-)-Angustifoline and Isoangustifoline, >95% (HPLC), Angustifoline, Angustifoline, ≥95%, ≥95%, Angustifoline, 95.0%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, HPC Standards. Available pack sizes: 0,5mg, 5mg, 1mg, 1 mg, 5 mg, 1x5mg.
(1S,2R,9S,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (CAS 550-43-6) is a chemical compound with the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. IUPAC name: (1S,2R,9S,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one. InChIKey: VTIPIBIDDZPDAV-ZDEQEGDKSA-N.
| Molecular formula | C14H22N2O |
|---|---|
| Molecular weight | 234.34 g/mol |
| IUPAC name | (1S,2R,9S,10S)-10-prop-2-enyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| InChIKey | VTIPIBIDDZPDAV-ZDEQEGDKSA-N |
| SMILES | C=CC[C@H]1[C@H]2C[C@@H](CN1)[C@H]3CCCC(=O)N3C2 |
Computed by PubChem (NCBI)