CAS 550-74-3 appears in our catalog under these names: Picrolonic acid, 95+%, Picrolonic acid/ 98+%, Picrolonic acid, Picrolonic acid, 99.4%. Offered by: AmBeed, Chemat, GLPBio, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 1 g, 500 mg, 250 mg.
5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one (CAS 550-74-3) is a chemical compound with the molecular formula C10H8N4O5 and a molecular weight of 264.19 g/mol. IUPAC name: 5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one. InChIKey: OVFUUSPKWADLNJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N4O5 |
|---|---|
| Molecular weight | 264.19 g/mol |
| IUPAC name | 5-methyl-4-nitro-2-(4-nitrophenyl)-4H-pyrazol-3-one |
| InChIKey | OVFUUSPKWADLNJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1[N+](=O)[O-])C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)