CAS 55003-96-8 is the registry number for Bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) maleate. Offered by: TRC. Available pack sizes: 250mg.
Bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (Z)-but-2-enedioate (CAS 55003-96-8) is a chemical compound with the molecular formula C20H10F26O4 and a molecular weight of 808.2 g/mol. IUPAC name: bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (Z)-but-2-enedioate. InChIKey: KTDHXHZTHVKJGC-UPHRSURJSA-N.
| Molecular formula | C20H10F26O4 |
|---|---|
| Molecular weight | 808.2 g/mol |
| IUPAC name | bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) (Z)-but-2-enedioate |
| InChIKey | KTDHXHZTHVKJGC-UPHRSURJSA-N |
| SMILES | C(COC(=O)/C=C\C(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)