CAS 5503-41-3 appears in our catalog under these names: Rhodium(II) acetate, 98%, Rhodium(II) acetate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Rhodium(2+) diacetate (CAS 5503-41-3) is a chemical compound with the molecular formula C4H6O4Rh and a molecular weight of 220.99 g/mol. IUPAC name: rhodium(2+) diacetate. InChIKey: ITDJKCJYYAQMRO-UHFFFAOYSA-L.
| Molecular formula | C4H6O4Rh |
|---|---|
| Molecular weight | 220.99 g/mol |
| IUPAC name | rhodium(2+) diacetate |
| InChIKey | ITDJKCJYYAQMRO-UHFFFAOYSA-L |
| SMILES | CC(=O)[O-].CC(=O)[O-].[Rh+2] |
Computed by PubChem (NCBI)