CAS 550366-69-3 is the registry number for 6-(4-Cyanophenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(4-cyanophenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide (CAS 550366-69-3) is a chemical compound with the molecular formula C11H7N5O2S2 and a molecular weight of 305.3 g/mol. IUPAC name: 6-(4-cyanophenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide. InChIKey: OLEUFDCZDWRTSD-UHFFFAOYSA-N.
| Molecular formula | C11H7N5O2S2 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 6-(4-cyanophenyl)imidazo[2,1-b][1,3,4]thiadiazole-2-sulfonamide |
| InChIKey | OLEUFDCZDWRTSD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CN3C(=N2)SC(=N3)S(=O)(=O)N |
Computed by PubChem (NCBI)