CAS 5504-72-3 appears in our catalog under these names: Nordiazepam Uncyclized Intermediate (hydrochloride), 2-Amino-N-(2-benzoyl-4-chlorophenyl)acetamide hydrochloride, 95%, 95%, Nordiazepam uncyclized intermediate (hydrochloride), 99.32%, Oxazepam Impurity 9. Offered by: GLPBio, Chemat, MedChemExpress, Chemat Brand. Available pack sizes: 1mg, 5mg, 250mg, 1g, 5g, 25g, 5 g, 1 g.
2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide;hydrochloride (CAS 5504-72-3) is a chemical compound with the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.2 g/mol. IUPAC name: 2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide;hydrochloride. InChIKey: KOHSAYNPKCTZOJ-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2N2O2 |
|---|---|
| Molecular weight | 325.2 g/mol |
| IUPAC name | 2-amino-N-(2-benzoyl-4-chlorophenyl)acetamide;hydrochloride |
| InChIKey | KOHSAYNPKCTZOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CN.Cl |
Computed by PubChem (NCBI)