Products 55063-97-3

CAS 55063-97-3 is the registry number for Methyl Methacrylate-3,3-d2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

Methyl 3,3-dideuterio-2-methylprop-2-enoate (CAS 55063-97-3) is a chemical compound with the molecular formula C5H8O2 and a molecular weight of 102.13 g/mol. IUPAC name: methyl 3,3-dideuterio-2-methylprop-2-enoate. InChIKey: VVQNEPGJFQJSBK-DICFDUPASA-N.

Identity
Molecular formulaC5H8O2
Molecular weight102.13 g/mol
IUPAC namemethyl 3,3-dideuterio-2-methylprop-2-enoate
InChIKeyVVQNEPGJFQJSBK-DICFDUPASA-N
SMILES[2H]C(=C(C)C(=O)OC)[2H]

Computed by PubChem (NCBI)