CAS 55066-41-6 appears in our catalog under these names: Baran mcms reagent, 95%, ZINC CHLOROMETHANESULFINATE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 10g, 1g.
Zinc chloromethanesulfinate (CAS 55066-41-6) is a chemical compound with the molecular formula C2H4Cl2O4S2Zn and a molecular weight of 292.5 g/mol. IUPAC name: zinc chloromethanesulfinate. InChIKey: HEKATMPPXNXYJU-UHFFFAOYSA-L.
| Molecular formula | C2H4Cl2O4S2Zn |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | zinc chloromethanesulfinate |
| InChIKey | HEKATMPPXNXYJU-UHFFFAOYSA-L |
| SMILES | C(S(=O)[O-])Cl.C(S(=O)[O-])Cl.[Zn+2] |
Computed by PubChem (NCBI)