Products 5508-89-4

CAS 5508-89-4 is the registry number for 2-(2,2-Dichloro-1-methylcyclopropyl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(2,2-dichloro-1-methylcyclopropyl)acetic acid (CAS 5508-89-4) is a chemical compound with the molecular formula C6H8Cl2O2 and a molecular weight of 183.03 g/mol. IUPAC name: 2-(2,2-dichloro-1-methylcyclopropyl)acetic acid. InChIKey: WYBGYUVVQBMZJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8Cl2O2
Molecular weight183.03 g/mol
IUPAC name2-(2,2-dichloro-1-methylcyclopropyl)acetic acid
InChIKeyWYBGYUVVQBMZJQ-UHFFFAOYSA-N
SMILESCC1(CC1(Cl)Cl)CC(=O)O

Computed by PubChem (NCBI)