CAS 55112-40-8 is the registry number for 2-(7-Chloro-1,8-naphthyridin-2-yl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(7-chloro-1,8-naphthyridin-2-yl)isoindole-1,3-dione (CAS 55112-40-8) is a chemical compound with the molecular formula C16H8ClN3O2 and a molecular weight of 309.70 g/mol. IUPAC name: 2-(7-chloro-1,8-naphthyridin-2-yl)isoindole-1,3-dione. InChIKey: XOZDDCDGCQEDRC-UHFFFAOYSA-N.
| Molecular formula | C16H8ClN3O2 |
|---|---|
| Molecular weight | 309.70 g/mol |
| IUPAC name | 2-(7-chloro-1,8-naphthyridin-2-yl)isoindole-1,3-dione |
| InChIKey | XOZDDCDGCQEDRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=NC4=C(C=C3)C=CC(=N4)Cl |
Computed by PubChem (NCBI)