CAS 55115-99-6 appears in our catalog under these names: Methisosildenafil Impurity 10, (3R,5S)-1-Benzyl-3,5-dimethylpiperazine, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
(3S,5R)-1-benzyl-3,5-dimethylpiperazine (CAS 55115-99-6) is a chemical compound with the molecular formula C13H20N2 and a molecular weight of 204.31 g/mol. IUPAC name: (3S,5R)-1-benzyl-3,5-dimethylpiperazine. InChIKey: HTDQGGNOPNSEKT-TXEJJXNPSA-N.
| Molecular formula | C13H20N2 |
|---|---|
| Molecular weight | 204.31 g/mol |
| IUPAC name | (3S,5R)-1-benzyl-3,5-dimethylpiperazine |
| InChIKey | HTDQGGNOPNSEKT-TXEJJXNPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)