CAS 55120-49-5 appears in our catalog under these names: 2-Chlorochrysene, 2-Chlorochrysene, 97%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g, 25g.
2-chlorochrysene (CAS 55120-49-5) is a chemical compound with the molecular formula C18H11Cl and a molecular weight of 262.7 g/mol. IUPAC name: 2-chlorochrysene. InChIKey: GEYDEIDXDHSFPX-UHFFFAOYSA-N.
| Molecular formula | C18H11Cl |
|---|---|
| Molecular weight | 262.7 g/mol |
| IUPAC name | 2-chlorochrysene |
| InChIKey | GEYDEIDXDHSFPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC(=C4)Cl |
Computed by PubChem (NCBI)