CAS 55123-62-1 is the registry number for rac-N-Desmethyl alpha-Methadol Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(3R,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol;hydrochloride (CAS 55123-62-1) is a chemical compound with the molecular formula C20H28ClNO and a molecular weight of 333.9 g/mol. IUPAC name: (3R,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol;hydrochloride. InChIKey: FOSJVWXKQNUFPB-LJLRIERRSA-N.
| Molecular formula | C20H28ClNO |
|---|---|
| Molecular weight | 333.9 g/mol |
| IUPAC name | (3R,6R)-6-(methylamino)-4,4-diphenylheptan-3-ol;hydrochloride |
| InChIKey | FOSJVWXKQNUFPB-LJLRIERRSA-N |
| SMILES | CC[C@H](C(C[C@@H](C)NC)(C1=CC=CC=C1)C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)