CAS 55129-06-1 is the registry number for (3Ar,6as)-5-benzylhexahydro-1h-furo[3,4-c]pyrrole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3aS,6aR)-5-benzyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (CAS 55129-06-1) is a chemical compound with the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. IUPAC name: (3aS,6aR)-5-benzyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole. InChIKey: CVRHDLHYOBFXGB-BETUJISGSA-N.
| Molecular formula | C13H17NO |
|---|---|
| Molecular weight | 203.28 g/mol |
| IUPAC name | (3aS,6aR)-5-benzyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| InChIKey | CVRHDLHYOBFXGB-BETUJISGSA-N |
| SMILES | C1[C@@H]2COC[C@@H]2CN1CC3=CC=CC=C3 |
Computed by PubChem (NCBI)