CAS 55135-66-5 appears in our catalog under these names: 9-Bromo-9-phenylfluorene, 9–Bromo–9–phenyl–9H–fluorene, 9-Bromo-9-phenylfluorene, 96% , 9-Bromo-9-phenylfluorene, 97%, 9-Bromo-9-phenylfluorene, >96.0%(GC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 2g, 500mg, 100g, 10g, 25g, 5g, 0,025kg.
9-bromo-9-phenylfluorene (CAS 55135-66-5) is a chemical compound with the molecular formula C19H13Br and a molecular weight of 321.2 g/mol. IUPAC name: 9-bromo-9-phenylfluorene. InChIKey: HYQXNCDBSALQLB-UHFFFAOYSA-N.
| Molecular formula | C19H13Br |
|---|---|
| Molecular weight | 321.2 g/mol |
| IUPAC name | 9-bromo-9-phenylfluorene |
| InChIKey | HYQXNCDBSALQLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)Br |
Computed by PubChem (NCBI)