CAS 55142-86-4 appears in our catalog under these names: Ticlopidine hydrochloride EP Impurity G, Ticlopidine Impurity 7(Ticlopidine EP Impurity G). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(3-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (CAS 55142-86-4) is a chemical compound with the molecular formula C14H14ClNS and a molecular weight of 263.8 g/mol. IUPAC name: 5-[(3-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine. InChIKey: OIOUADIQAAAVRC-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNS |
|---|---|
| Molecular weight | 263.8 g/mol |
| IUPAC name | 5-[(3-chlorophenyl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| InChIKey | OIOUADIQAAAVRC-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1SC=C2)CC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)