CAS 551919-56-3 appears in our catalog under these names: Bis(2-cyclopropylguanidine), sulfuric acid, 95%, N-Cyclopropylguanidine hemisulfate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 50mg, 250mg, 1000mg, 500mg.
Bis(2-cyclopropylguanidine);sulfuric acid (CAS 551919-56-3) is a chemical compound with the molecular formula C8H20N6O4S and a molecular weight of 296.35 g/mol. IUPAC name: bis(2-cyclopropylguanidine);sulfuric acid. InChIKey: TWFCSULVULHFGH-UHFFFAOYSA-N.
| Molecular formula | C8H20N6O4S |
|---|---|
| Molecular weight | 296.35 g/mol |
| IUPAC name | bis(2-cyclopropylguanidine);sulfuric acid |
| InChIKey | TWFCSULVULHFGH-UHFFFAOYSA-N |
| SMILES | C1CC1N=C(N)N.C1CC1N=C(N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)