CAS 551936-38-0 appears in our catalog under these names: (1R,2S)-Rel-2-aminocyclobutanecarboxylic acid hydrochloride, 95%, cis-2-Aminocyclobutanecarboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
Cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid;hydrochloride (CAS 551936-38-0) is a chemical compound with the molecular formula C5H10ClNO2 and a molecular weight of 151.59 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid;hydrochloride. InChIKey: YDUYWOJGABHCAO-HJXLNUONSA-N.
| Molecular formula | C5H10ClNO2 |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclobutane-1-carboxylic acid;hydrochloride |
| InChIKey | YDUYWOJGABHCAO-HJXLNUONSA-N |
| SMILES | C1C[C@@H]([C@@H]1C(=O)O)N.Cl |
Computed by PubChem (NCBI)