CAS 55199-56-9 appears in our catalog under these names: 8-Demethyl-6-hydroxy Zolazepam, >95% (HPLC), 8-Demethyl-6-hydroxy zolazepam. Offered by: TRC, Biosynth. Available pack sizes: 1mg, 2,5mg, 2mg, 5mg, 10mg, 25mg.
4-(2-fluorophenyl)-6-hydroxy-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one (CAS 55199-56-9) is a chemical compound with the molecular formula C14H13FN4O2 and a molecular weight of 288.28 g/mol. IUPAC name: 4-(2-fluorophenyl)-6-hydroxy-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one. InChIKey: QLWKALCTVFAIMR-UHFFFAOYSA-N.
| Molecular formula | C14H13FN4O2 |
|---|---|
| Molecular weight | 288.28 g/mol |
| IUPAC name | 4-(2-fluorophenyl)-6-hydroxy-1,3-dimethyl-6,8-dihydropyrazolo[5,4-e][1,4]diazepin-7-one |
| InChIKey | QLWKALCTVFAIMR-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NC(C(=O)N2)O)C3=CC=CC=C3F)C |
Computed by PubChem (NCBI)