CAS 552-22-7 appears in our catalog under these names: Thymol iodide, 95%, Thymol Iodide, Thymol iodide, Thymol iodide, 42.00%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25g, 1g, 5g, on request, 100mg, 500mg, 1 g, 500 mg.
[4-(4-iodooxy-2-methyl-5-propan-2-ylphenyl)-5-methyl-2-propan-2-ylphenyl] hypoiodite (CAS 552-22-7) is a chemical compound with the molecular formula C20H24I2O2 and a molecular weight of 550.2 g/mol. IUPAC name: [4-(4-iodooxy-2-methyl-5-propan-2-ylphenyl)-5-methyl-2-propan-2-ylphenyl] hypoiodite. InChIKey: SHOKWSLXDAIZPP-UHFFFAOYSA-N.
| Molecular formula | C20H24I2O2 |
|---|---|
| Molecular weight | 550.2 g/mol |
| IUPAC name | [4-(4-iodooxy-2-methyl-5-propan-2-ylphenyl)-5-methyl-2-propan-2-ylphenyl] hypoiodite |
| InChIKey | SHOKWSLXDAIZPP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC(=C(C=C2C)OI)C(C)C)C(C)C)OI |
Computed by PubChem (NCBI)