CAS 552-37-4 appears in our catalog under these names: 2-Aminobenzoic Acid Sodium Salt, >95% (HPLC), 2–Aminobenzoic Acid Sodium Salt, 2-Aminobenzoic acid sodium salt. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1g, 500mg, 5g, 10g, 25g, 50g, 100g.
Sodium 2-aminobenzoate (CAS 552-37-4) is a chemical compound with the molecular formula C7H6NNaO2 and a molecular weight of 159.12 g/mol. IUPAC name: sodium 2-aminobenzoate. InChIKey: HCKKSLZDSNNSTL-UHFFFAOYSA-M.
| Molecular formula | C7H6NNaO2 |
|---|---|
| Molecular weight | 159.12 g/mol |
| IUPAC name | sodium 2-aminobenzoate |
| InChIKey | HCKKSLZDSNNSTL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])N.[Na+] |
Computed by PubChem (NCBI)