CAS 55206-11-6 appears in our catalog under these names: 4-Hydroxytryptamine Creatinine Sulfate, >95% (HPLC), 4–Hydroxytryptamine creatinine sulfate, 4-Hydroxytryptamine creatinine sulfate, 97.94%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 1mg, 1 mg.
3-(2-aminoethyl)-1H-indol-4-ol;2-imino-1-methylimidazolidin-4-one;sulfuric acid (CAS 55206-11-6) is a chemical compound with the molecular formula C14H21N5O6S and a molecular weight of 387.41 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indol-4-ol;2-imino-1-methylimidazolidin-4-one;sulfuric acid. InChIKey: QDVAUZIQCAKHIU-UHFFFAOYSA-N.
| Molecular formula | C14H21N5O6S |
|---|---|
| Molecular weight | 387.41 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indol-4-ol;2-imino-1-methylimidazolidin-4-one;sulfuric acid |
| InChIKey | QDVAUZIQCAKHIU-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC1=N.C1=CC2=C(C(=C1)O)C(=CN2)CCN.OS(=O)(=O)O |
Computed by PubChem (NCBI)