CAS 5522-55-4 appears in our catalog under these names: Uracil-15N2, >95% (HPLC), Uracil-¹⁵N2, ≥98 atom% 15N, ≥98 atom% 15N, Uracil-15N2, 99.4%. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 250mg, 500mg, 50mg, 25mg, 10 mg, 25 mg.
(1,3-15N2)1H-pyrimidine-2,4-dione (CAS 5522-55-4) is a chemical compound with the molecular formula C4H4N2O2 and a molecular weight of 114.07 g/mol. IUPAC name: (1,3-15N2)1H-pyrimidine-2,4-dione. InChIKey: ISAKRJDGNUQOIC-MPOCSFTDSA-N.
| Molecular formula | C4H4N2O2 |
|---|---|
| Molecular weight | 114.07 g/mol |
| IUPAC name | (1,3-15N2)1H-pyrimidine-2,4-dione |
| InChIKey | ISAKRJDGNUQOIC-MPOCSFTDSA-N |
| SMILES | C1=C[15NH]C(=O)[15NH]C1=O |
Computed by PubChem (NCBI)