CAS 552311-06-5 is the registry number for 1-Cyclohexyl-1-((7,8-dimethyl-2-oxo-1,2-dihydroquinolin-3-yl)methyl)-3-phenylurea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclohexyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylurea (CAS 552311-06-5) is a chemical compound with the molecular formula C25H29N3O2 and a molecular weight of 403.5 g/mol. IUPAC name: 1-cyclohexyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylurea. InChIKey: JDXXXJZVGJSURS-UHFFFAOYSA-N.
| Molecular formula | C25H29N3O2 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 1-cyclohexyl-1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-phenylurea |
| InChIKey | JDXXXJZVGJSURS-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=C(C(=O)N2)CN(C3CCCCC3)C(=O)NC4=CC=CC=C4)C |
Computed by PubChem (NCBI)