CAS 552330-86-6 appears in our catalog under these names: 5–Bromo–2,3–dihydro–1H–isoindol–1–one, 5-Bromoisoindolin-1-one, >98.0%(GC), 5-Bromo-2,3-Dihydroisoindol-1-One, 95%, 95%, 5-Bromo-2,3-dihydro-1H-isoindol-1-one, 99.95%, 5-Bromo-2,3-dihydroisoindol-1-one, 95%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 50g, 100g, 5 g, 10 g.
5-bromo-2,3-dihydroisoindol-1-one (CAS 552330-86-6) is a chemical compound with the molecular formula C8H6BrNO and a molecular weight of 212.04 g/mol. IUPAC name: 5-bromo-2,3-dihydroisoindol-1-one. InChIKey: WJNKJYJCWXMBNV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO |
|---|---|
| Molecular weight | 212.04 g/mol |
| IUPAC name | 5-bromo-2,3-dihydroisoindol-1-one |
| InChIKey | WJNKJYJCWXMBNV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)Br)C(=O)N1 |
Computed by PubChem (NCBI)