CAS 552845-68-8 is the registry number for 4-Fluoro-3-(thiophen-2-yl)benzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-fluoro-3-thiophen-2-ylbenzaldehyde (CAS 552845-68-8) is a chemical compound with the molecular formula C11H7FOS and a molecular weight of 206.24 g/mol. IUPAC name: 4-fluoro-3-thiophen-2-ylbenzaldehyde. InChIKey: BLEFDUIBXHMJPM-UHFFFAOYSA-N.
| Molecular formula | C11H7FOS |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-fluoro-3-thiophen-2-ylbenzaldehyde |
| InChIKey | BLEFDUIBXHMJPM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(C=CC(=C2)C=O)F |
Computed by PubChem (NCBI)