Products 55290-68-1
CAS 55290-68-1 appears in our catalog under these names: Trazodone EP Impurity A (Trazodone Hydrochloride BP Impurity A, Trazodone N1-Oxide), Trazodone hydrochloride Impurity A, Trazodone N1-Oxide, Trazodone N-Oxide, >95% (HPLC), Trazodone Hydrochloride BP Impurity A. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 5mg, 2mg, 10mg, 25mg.
2-[3-[4-(3-chlorophenyl)-1-oxidopiperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 55290-68-1) is a chemical compound with the molecular formula C19H22ClN5O2 and a molecular weight of 387.9 g/mol. IUPAC name: 2-[3-[4-(3-chlorophenyl)-1-oxidopiperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: WPWLJYFNNKOAFU-UHFFFAOYSA-N.
| Molecular formula | C19H22ClN5O2 |
|---|---|
| Molecular weight | 387.9 g/mol |
| IUPAC name | 2-[3-[4-(3-chlorophenyl)-1-oxidopiperazin-1-ium-1-yl]propyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | WPWLJYFNNKOAFU-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C2=CC(=CC=C2)Cl)(CCCN3C(=O)N4C=CC=CC4=N3)[O-] |
Computed by PubChem (NCBI)