CAS 55304-72-8 appears in our catalog under these names: 2,3,6-Trichloro-5-nitropyridine 95%, 2,3,6-Trichloro-5-nitro-pyridine, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
2,3,6-trichloro-5-nitropyridine (CAS 55304-72-8) is a chemical compound with the molecular formula C5HCl3N2O2 and a molecular weight of 227.43 g/mol. IUPAC name: 2,3,6-trichloro-5-nitropyridine. InChIKey: KPXAMNWVBHLRRG-UHFFFAOYSA-N.
| Molecular formula | C5HCl3N2O2 |
|---|---|
| Molecular weight | 227.43 g/mol |
| IUPAC name | 2,3,6-trichloro-5-nitropyridine |
| InChIKey | KPXAMNWVBHLRRG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)