Products 55306-12-2
CAS 55306-12-2 is the registry number for Dactylyne. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,5S,6S)-3-bromo-2-[(Z)-3-bromopent-2-enyl]-5-chloro-6-[(E)-pent-2-en-4-ynyl]oxane (CAS 55306-12-2) is a chemical compound with the molecular formula C15H19Br2ClO and a molecular weight of 410.57 g/mol. IUPAC name: (2R,3R,5S,6S)-3-bromo-2-[(Z)-3-bromopent-2-enyl]-5-chloro-6-[(E)-pent-2-en-4-ynyl]oxane. InChIKey: NZHWXNQBZKBACG-MJYPMMBJSA-N.
| Molecular formula | C15H19Br2ClO |
|---|---|
| Molecular weight | 410.57 g/mol |
| IUPAC name | (2R,3R,5S,6S)-3-bromo-2-[(Z)-3-bromopent-2-enyl]-5-chloro-6-[(E)-pent-2-en-4-ynyl]oxane |
| InChIKey | NZHWXNQBZKBACG-MJYPMMBJSA-N |
| SMILES | CC/C(=C/C[C@@H]1[C@@H](C[C@@H]([C@@H](O1)C/C=C/C#C)Cl)Br)/Br |
Computed by PubChem (NCBI)