CAS 55320-91-7 appears in our catalog under these names: 6-Methyl-5-hepten-2-one-1,1,1,3,3-d5, Sulcatone-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 250mg, 5 mg, 10 mg, 50 mg, 25 mg, 100 mg.
1,1,1,3,3-pentadeuterio-6-methylhept-5-en-2-one (CAS 55320-91-7) is a chemical compound with the molecular formula C8H14O and a molecular weight of 131.23 g/mol. IUPAC name: 1,1,1,3,3-pentadeuterio-6-methylhept-5-en-2-one. InChIKey: UHEPJGULSIKKTP-SBRIIUNQSA-N.
| Molecular formula | C8H14O |
|---|---|
| Molecular weight | 131.23 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuterio-6-methylhept-5-en-2-one |
| InChIKey | UHEPJGULSIKKTP-SBRIIUNQSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CC=C(C)C |
Computed by PubChem (NCBI)