CAS 55322-48-0 appears in our catalog under these names: Potassium 3-phenylpropanoate, 95%, Benzenepropanoic acid, potassium salt, 3-phenylpropionic acid, potassium salt, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 10g, 1g.
Potassium 3-phenylpropanoate (CAS 55322-48-0) is a chemical compound with the molecular formula C9H9KO2 and a molecular weight of 188.26 g/mol. IUPAC name: potassium 3-phenylpropanoate. InChIKey: DPAGNRMJGYANDY-UHFFFAOYSA-M.
| Molecular formula | C9H9KO2 |
|---|---|
| Molecular weight | 188.26 g/mol |
| IUPAC name | potassium 3-phenylpropanoate |
| InChIKey | DPAGNRMJGYANDY-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)