Products 55332-76-8
CAS 55332-76-8 is the registry number for Agigenin. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg.
Agigenin is an oxaspiro compound that is (25R)-5alpha-spirostan substituted by hydroxy groups at positions 2, 3 and 6 (the 2alpha,3beta,6beta stereoisomer). It has a role as a metabolite and an antineoplastic agent. It is a 3beta-hydroxy steroid, a 2alpha-hydroxy steroid, an oxaspiro compound and an organic heterohexacyclic compound. It derives from a hydride of a (25R)-5alpha-spirostan.
Source: ChEBI
| Molecular formula | C27H44O5 |
|---|---|
| Molecular weight | 448.6 g/mol |
| IUPAC name | (1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18S,19R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,19-triol |
| InChIKey | FYRLHXNMINIDCB-LEGLVIAUSA-N |
| SMILES | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@H]([C@@H]6[C@@]5(C[C@H]([C@@H](C6)O)O)C)O)C)C)OC1 |
Computed by PubChem (NCBI)
Synonyms:
Agigenin, Spirostan-2,3,6-triol, (2alpha,3beta,5alpha,6beta,25R)-, (25R)-5alpha-spirostan-2alpha,3beta,6beta-triol, AGIGENIN [USP-RS], (25r)-5alpha-spirostane-2alpha,3beta,6beta-triol, (2alpha,3beta,5alpha,6beta,25R)-spirostan-2,3,6-triol, Spirostan-2,3,6-triol, (2I+/-,3I(2),5I+/-,6I(2),25R)-