CAS 55399-92-3 appears in our catalog under these names: (2S,3R,4R)-2-Amino-4-hydroxy-3-methylpentanoic acid, 98+%, 4-Hydroxy-l-isoleucine, ≥95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(2S,3R,4R)-2-amino-4-hydroxy-3-methylpentanoic acid (CAS 55399-92-3) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3R,4R)-2-amino-4-hydroxy-3-methylpentanoic acid. InChIKey: OSCCDBFHNMXNME-LMVFSUKVSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2S,3R,4R)-2-amino-4-hydroxy-3-methylpentanoic acid |
| InChIKey | OSCCDBFHNMXNME-LMVFSUKVSA-N |
| SMILES | C[C@@H]([C@@H](C)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)