CAS 554-73-4 appears in our catalog under these names: 4-(4-Anilinophenylazo)benzenesulfonic acid sodium salt, indicator grade, OrangeIV, 98+%, Orange IV, Tropaeolin OO, OrangeIV. Offered by: Thermo Scientific (Acros), AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1KG, 25g, 100g, 5g, 50g, 250g, 500g, Get quote.
Sodium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate (CAS 554-73-4) is a chemical compound with the molecular formula C18H14N3NaO3S and a molecular weight of 375.4 g/mol. IUPAC name: sodium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate. InChIKey: MLVYOYVMOZFHIU-UHFFFAOYSA-M.
| Molecular formula | C18H14N3NaO3S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | sodium 4-[(4-anilinophenyl)diazenyl]benzenesulfonate |
| InChIKey | MLVYOYVMOZFHIU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N=NC3=CC=C(C=C3)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)