CAS 554-88-1 appears in our catalog under these names: Glucoiberin, Glucoiberin, ROTICHROM® HPLC, 10 mg, glass. Offered by: TRC, Biosynth, MedChemExpress, Roth. Available pack sizes: 25mg, 10mg, 5mg, 50mg, Get quote.
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-methylsulfinyl-N-sulfooxybutanimidothioate (CAS 554-88-1) is a chemical compound with the molecular formula C11H21NO10S3 and a molecular weight of 423.5 g/mol. IUPAC name: [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-methylsulfinyl-N-sulfooxybutanimidothioate. InChIKey: PHYYADMVYQURSX-GEINXPCQSA-N.
| Molecular formula | C11H21NO10S3 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 4-methylsulfinyl-N-sulfooxybutanimidothioate |
| InChIKey | PHYYADMVYQURSX-GEINXPCQSA-N |
| SMILES | CS(=O)CCCC(=NOS(=O)(=O)O)S[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)